C27H23NO6 — CID 163110335
1-(2,4-dihydroxy-6-methylphenyl)-8,10,12-trihydroxy-3,6,6-trimethylnaphtho[3,2-g]isoquinolin-11-one (PubChem CID 163110335) has the molecular formula C27H23NO6 and a molecular weight of 457.48 g/mol. Its IUPAC name is 1-(2,4-dihydroxy-6-methylphenyl)-8,10,12-trihydroxy-3,6,6-trimethylnaphtho[3,2-g]isoquinolin-11-one.
| Compound Name | 1-(2,4-dihydroxy-6-methylphenyl)-8,10,12-trihydroxy-3,6,6-trimethylnaphtho[3,2-g]isoquinolin-11-one |
|---|---|
| PubChem CID | 163110335 |
| Molecular Formula | C27H23NO6 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 1-(2,4-dihydroxy-6-methylphenyl)-8,10,12-trihydroxy-3,6,6-trimethylnaphtho[3,2-g]isoquinolin-11-one |
| SMILES | Cc1cc2cc3c(c(O)c2c(-c2c(C)cc(O)cc2O)n1)C(=O)c1c(O)cc(O)cc1C3(C)C |
| InChI | InChI=1S/C27H23NO6/c1-11-5-14(29)9-18(31)20(11)24-21-13(6-12(2)28-24)7-16-23(25(21)33)26(34)22-17(27(16,3)4)8-15(30)10-19(22)32/h5-10,29-33H,1-4H3 |
| InChIKey | KBGWOSVCJRWWKU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |