C12H10O4 — CID 102032958
6-(2,4-dihydroxy-6-methylphenyl)pyran-2-one (PubChem CID 102032958) has the molecular formula C12H10O4 and a molecular weight of 218.21 g/mol. Its IUPAC name is 6-(2,4-dihydroxy-6-methylphenyl)pyran-2-one.
| Compound Name | 6-(2,4-dihydroxy-6-methylphenyl)pyran-2-one |
|---|---|
| PubChem CID | 102032958 |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 6-(2,4-dihydroxy-6-methylphenyl)pyran-2-one |
| SMILES | Cc1cc(O)cc(O)c1-c1cccc(=O)o1 |
| InChI | InChI=1S/C12H10O4/c1-7-5-8(13)6-9(14)12(7)10-3-2-4-11(15)16-10/h2-6,13-14H,1H3 |
| InChIKey | YKXBEKHKCNXYKR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |