C30H29ClO8 — CID 163112488
10-chloro-7-(2,4-dimethoxy-6-methylphenyl)-2,4,5a-trihydroxy-9-methoxy-12,12-dimethyl-11,11a-dihydrotetracene-5,6-dione (PubChem CID 163112488) has the molecular formula C30H29ClO8 and a molecular weight of 553.01 g/mol. Its IUPAC name is 10-chloro-7-(2,4-dimethoxy-6-methylphenyl)-2,4,5a-trihydroxy-9-methoxy-12,12-dimethyl-11,11a-dihydrotetracene-5,6-dione.
| Compound Name | 10-chloro-7-(2,4-dimethoxy-6-methylphenyl)-2,4,5a-trihydroxy-9-methoxy-12,12-dimethyl-11,11a-dihydrotetracene-5,6-dione |
|---|---|
| PubChem CID | 163112488 |
| Molecular Formula | C30H29ClO8 |
| Molecular Weight | 553.01 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | 10-chloro-7-(2,4-dimethoxy-6-methylphenyl)-2,4,5a-trihydroxy-9-methoxy-12,12-dimethyl-11,11a-dihydrotetracene-5,6-dione |
| SMILES | COc1cc(C)c(-c2cc(OC)c(Cl)c3c2C(=O)C2(O)C(=O)c4c(O)cc(O)cc4C(C)(C)C2C3)c(OC)c1 |
| InChI | InChI=1S/C30H29ClO8/c1-13-7-15(37-4)10-20(38-5)23(13)16-11-21(39-6)26(31)17-12-22-29(2,3)18-8-14(32)9-19(33)25(18)28(35)30(22,36)27(34)24(16)17/h7-11,22,32-33,36H,12H2,1-6H3 |
| InChIKey | PYYNLZYNJIYAOW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.01 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|