C46H60N6O — CID 163115024
25-[bis[3-(2-aminoethyl)-1H-indol-2-yl]methyl]-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-13-ol (PubChem CID 163115024) has the molecular formula C46H60N6O and a molecular weight of 713.03 g/mol. Its IUPAC name is 25-[bis[3-(2-aminoethyl)-1H-indol-2-yl]methyl]-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-13-ol.
| Compound Name | 25-[bis[3-(2-aminoethyl)-1H-indol-2-yl]methyl]-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-13-ol |
|---|---|
| PubChem CID | 163115024 |
| Molecular Formula | C46H60N6O |
| Molecular Weight | 713.03 g/mol |
| Exact Mass | 712.48 |
| IUPAC Name | 25-[bis[3-(2-aminoethyl)-1H-indol-2-yl]methyl]-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-13-ol |
| SMILES | NCCc1c(C(C2=CC3(O)CCC=CCCCCN4CCC2C2(CC5C=CCCCCN5C32)C4)c2[nH]c3ccccc3c2CCN)[nH]c2ccccc12 |
| InChI | InChI=1S/C46H60N6O/c47-24-20-35-33-16-8-10-18-39(33)49-42(35)41(43-36(21-25-48)34-17-9-11-19-40(34)50-43)37-30-46(53)23-12-4-1-2-5-13-26-51-28-22-38(37)45(31-51)29-32-15-7-3-6-14-27-52(32)44(45)46/h1,4,7-11,15-19,30,32,38,41,44,49-50,53H,2-3,5-6,12-14,20-29,31,47-48H2 |
| InChIKey | WQVJPVYQHHDNFK-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.03 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|