C31H50N2O2 — CID 163115338
2-[(1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methyl]-3-hydroxy-4-(3-methylbutylamino)-6-(3-methylbutylimino)cyclohexa-2,4-dien-1-one (PubChem CID 163115338) has the molecular formula C31H50N2O2 and a molecular weight of 482.75 g/mol. Its IUPAC name is 2-[(1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methyl]-3-hydroxy-4-(3-methylbutylamino)-6-(3-methylbutylimino)cyclohexa-2,4-dien-1-one.
| Compound Name | 2-[(1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methyl]-3-hydroxy-4-(3-methylbutylamino)-6-(3-methylbutylimino)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 163115338 |
| Molecular Formula | C31H50N2O2 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.39 |
| IUPAC Name | 2-[(1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methyl]-3-hydroxy-4-(3-methylbutylamino)-6-(3-methylbutylimino)cyclohexa-2,4-dien-1-one |
| SMILES | C=C1CCCC2C1(C)CCC(C)C2(C)CC1=C(O)C(NCCC(C)C)=C/C(=N\CCC(C)C)C1=O |
| InChI | InChI=1S/C31H50N2O2/c1-20(2)13-16-32-25-18-26(33-17-14-21(3)4)29(35)24(28(25)34)19-31(8)23(6)12-15-30(7)22(5)10-9-11-27(30)31/h18,20-21,23,27,32,34H,5,9-17,19H2,1-4,6-8H3/b33-26+ |
| InChIKey | CQNMGPMOXZZIMT-MHTZHOPKSA-N |
| XLogP | 7.58 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|