C43H76N6O6S2 — CID 163117960
[10-amino-6-[(2-aminopiperidin-4-yl)methyl]-28-cyclopentyloxy-21,29-dihydroxy-4-oxospiro[13,14-dithia-3,9,11-triazatricyclo[24.3.1.13,6]hentriacont-9-ene-12,1'-cyclopentane]-23-yl] acetate (PubChem CID 163117960) has the molecular formula C43H76N6O6S2 and a molecular weight of 837.25 g/mol. Its IUPAC name is [10-amino-6-[(2-aminopiperidin-4-yl)methyl]-28-cyclopentyloxy-21,29-dihydroxy-4-oxospiro[13,14-dithia-3,9,11-triazatricyclo[24.3.1.13,6]hentriacont-9-ene-12,1'-cyclopentane]-23-yl] acetate.
| Compound Name | [10-amino-6-[(2-aminopiperidin-4-yl)methyl]-28-cyclopentyloxy-21,29-dihydroxy-4-oxospiro[13,14-dithia-3,9,11-triazatricyclo[24.3.1.13,6]hentriacont-9-ene-12,1'-cyclopentane]-23-yl] acetate |
|---|---|
| PubChem CID | 163117960 |
| Molecular Formula | C43H76N6O6S2 |
| Molecular Weight | 837.25 g/mol |
| Exact Mass | 836.53 |
| IUPAC Name | [10-amino-6-[(2-aminopiperidin-4-yl)methyl]-28-cyclopentyloxy-21,29-dihydroxy-4-oxospiro[13,14-dithia-3,9,11-triazatricyclo[24.3.1.13,6]hentriacont-9-ene-12,1'-cyclopentane]-23-yl] acetate |
| SMILES | CC(=O)OC1CCC2CC(CN3CC(CC4CCNC(N)C4)(CC/N=C(\N)NC4(CCCC4)SSCCCCCCC(O)C1)CC3=O)C(O)C(OC1CCCC1)C2 |
| InChI | InChI=1S/C43H76N6O6S2/c1-30(50)54-36-14-13-31-22-33(40(53)37(23-31)55-35-11-5-6-12-35)28-49-29-42(27-39(49)52,26-32-15-19-46-38(44)24-32)18-20-47-41(45)48-43(16-7-8-17-43)57-56-21-9-3-2-4-10-34(51)25-36/h31-38,40,46,51,53H,2-29,44H2,1H3,(H3,45,47,48) |
| InChIKey | HHFPXSXFDCHOTO-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 184.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.25 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|