C20H33NO5 — CID 163118246
(11S)-16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosan-11-ol (PubChem CID 163118246) has the molecular formula C20H33NO5 and a molecular weight of 367.49 g/mol. Its IUPAC name is (11S)-16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosan-11-ol.
| Compound Name | (11S)-16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosan-11-ol |
|---|---|
| PubChem CID | 163118246 |
| Molecular Formula | C20H33NO5 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | (11S)-16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosan-11-ol |
| SMILES | COC1CCC2CC3C4CC5OCOC5CC4[C@H](O)CN3CC2C1OC |
| InChI | InChI=1S/C20H33NO5/c1-23-17-4-3-11-5-15-12-6-18-19(26-10-25-18)7-13(12)16(22)9-21(15)8-14(11)20(17)24-2/h11-20,22H,3-10H2,1-2H3/t11?,12?,13?,14?,15?,16-,17?,18?,19?,20?/m1/s1 |
| InChIKey | IMXHQBZDNQWVPM-FCTIFIRSSA-N |
| XLogP | 1.26 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |