C20H36NO4+ — CID 163119712
2,9,10-trimethoxy-1,2,3,4,4a,5,6,7,8,8a,9,10,11,12,12a,13,13a,13b-octadecahydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol (PubChem CID 163119712) has the molecular formula C20H36NO4+ and a molecular weight of 354.51 g/mol. Its IUPAC name is 2,9,10-trimethoxy-1,2,3,4,4a,5,6,7,8,8a,9,10,11,12,12a,13,13a,13b-octadecahydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol.
| Compound Name | 2,9,10-trimethoxy-1,2,3,4,4a,5,6,7,8,8a,9,10,11,12,12a,13,13a,13b-octadecahydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
|---|---|
| PubChem CID | 163119712 |
| Molecular Formula | C20H36NO4+ |
| Molecular Weight | 354.51 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | 2,9,10-trimethoxy-1,2,3,4,4a,5,6,7,8,8a,9,10,11,12,12a,13,13a,13b-octadecahydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol |
| SMILES | COC1CC2C(CC[NH+]3CC4C(CCC(OC)C4OC)CC23)CC1O |
| InChI | InChI=1S/C20H35NO4/c1-23-18-5-4-12-8-16-14-10-19(24-2)17(22)9-13(14)6-7-21(16)11-15(12)20(18)25-3/h12-20,22H,4-11H2,1-3H3/p+1 |
| InChIKey | PRSYWMGENLRBTE-UHFFFAOYSA-O |
| XLogP | 0.51 |
| TPSA | 52.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.51 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |