C23H41NO4 — CID 163144457
2,9,10-triethoxy-2,3,4,4a,5,6,8,8a,9,10,11,12,12a,13,13a,13b-hexadecahydro-1H-isoquinolino[2,1-b]isoquinolin-3-ol (PubChem CID 163144457) has the molecular formula C23H41NO4 and a molecular weight of 395.58 g/mol. Its IUPAC name is 2,9,10-triethoxy-2,3,4,4a,5,6,8,8a,9,10,11,12,12a,13,13a,13b-hexadecahydro-1H-isoquinolino[2,1-b]isoquinolin-3-ol.
| Compound Name | 2,9,10-triethoxy-2,3,4,4a,5,6,8,8a,9,10,11,12,12a,13,13a,13b-hexadecahydro-1H-isoquinolino[2,1-b]isoquinolin-3-ol |
|---|---|
| PubChem CID | 163144457 |
| Molecular Formula | C23H41NO4 |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.30 |
| IUPAC Name | 2,9,10-triethoxy-2,3,4,4a,5,6,8,8a,9,10,11,12,12a,13,13a,13b-hexadecahydro-1H-isoquinolino[2,1-b]isoquinolin-3-ol |
| SMILES | CCOC1CC2C(CCN3CC4C(CCC(OCC)C4OCC)CC23)CC1O |
| InChI | InChI=1S/C23H41NO4/c1-4-26-21-8-7-15-11-19-17-13-22(27-5-2)20(25)12-16(17)9-10-24(19)14-18(15)23(21)28-6-3/h15-23,25H,4-14H2,1-3H3 |
| InChIKey | FWZJVPOQBWJAJI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |