C12H17NO8 — CID 163119485
N-hydroxy-2-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzeneamine oxide (PubChem CID 163119485) has the molecular formula C12H17NO8 and a molecular weight of 303.27 g/mol. Its IUPAC name is N-hydroxy-2-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzeneamine oxide.
| Compound Name | N-hydroxy-2-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzeneamine oxide |
|---|---|
| PubChem CID | 163119485 |
| Molecular Formula | C12H17NO8 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-hydroxy-2-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzeneamine oxide |
| SMILES | [O-][NH+](O)c1ccccc1O[C@H]1O[C@H](CO)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H17NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-4-2-1-3-6(7)13(18)19/h1-4,8-18H,5H2/t8-,9+,10-,11-,12+/m1/s1 |
| InChIKey | BAFAOBZDHKZMLC-ROHXPCBUSA-N |
| XLogP | -2.73 |
| TPSA | 147.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|