C12H16NO8- — CID 163119494
(2R,3R,4R,5S,6R)-2-(hydroxymethyl)-6-[2-[hydroxy(oxido)amino]phenoxy]oxane-3,4,5-triol (PubChem CID 163119494) has the molecular formula C12H16NO8- and a molecular weight of 302.26 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-2-(hydroxymethyl)-6-[2-[hydroxy(oxido)amino]phenoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S,6R)-2-(hydroxymethyl)-6-[2-[hydroxy(oxido)amino]phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163119494 |
| Molecular Formula | C12H16NO8- |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (2R,3R,4R,5S,6R)-2-(hydroxymethyl)-6-[2-[hydroxy(oxido)amino]phenoxy]oxane-3,4,5-triol |
| SMILES | [O-]N(O)c1ccccc1O[C@H]1O[C@H](CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H16NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-4-2-1-3-6(7)13(18)19/h1-4,8-12,14-18H,5H2/q-1/t8-,9+,10-,11+,12+/m1/s1 |
| InChIKey | MOASSJPYZOAUOT-LVEVGFFFSA-N |
| XLogP | -1.44 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|