C18H22N2O2 — CID 163119547
(1S,2S,3S,6S,7S,8R)-1-ethyl-8-phenyl-11-oxa-9,10-diazatetracyclo[6.2.2.13,6.02,7]tridecan-12-one (PubChem CID 163119547) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (1S,2S,3S,6S,7S,8R)-1-ethyl-8-phenyl-11-oxa-9,10-diazatetracyclo[6.2.2.13,6.02,7]tridecan-12-one.
| Compound Name | (1S,2S,3S,6S,7S,8R)-1-ethyl-8-phenyl-11-oxa-9,10-diazatetracyclo[6.2.2.13,6.02,7]tridecan-12-one |
|---|---|
| PubChem CID | 163119547 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (1S,2S,3S,6S,7S,8R)-1-ethyl-8-phenyl-11-oxa-9,10-diazatetracyclo[6.2.2.13,6.02,7]tridecan-12-one |
| SMILES | CC[C@]12NN[C@](c3ccccc3)(C(=O)O1)[C@H]1[C@H]3CC[C@@H](C3)[C@@H]12 |
| InChI | InChI=1S/C18H22N2O2/c1-2-17-14-11-8-9-12(10-11)15(14)18(20-19-17,16(21)22-17)13-6-4-3-5-7-13/h3-7,11-12,14-15,19-20H,2,8-10H2,1H3/t11-,12-,14-,15-,17-,18-/m0/s1 |
| InChIKey | BAVFGQJXXRGGGO-DWEGKCPBSA-N |
| XLogP | 2.32 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |