C16H30N2O — CID 163122234
(4aS,5R,7S,8aS)-7-methyl-5-[(1-oxidopiperidin-1-ium-2-yl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline (PubChem CID 163122234) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is (4aS,5R,7S,8aS)-7-methyl-5-[(1-oxidopiperidin-1-ium-2-yl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline.
| Compound Name | (4aS,5R,7S,8aS)-7-methyl-5-[(1-oxidopiperidin-1-ium-2-yl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
|---|---|
| PubChem CID | 163122234 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | (4aS,5R,7S,8aS)-7-methyl-5-[(1-oxidopiperidin-1-ium-2-yl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
| SMILES | C[C@H]1C[C@H](CC2CCCC[NH+]2[O-])[C@@H]2CCCN[C@H]2C1 |
| InChI | InChI=1S/C16H30N2O/c1-12-9-13(11-14-5-2-3-8-18(14)19)15-6-4-7-17-16(15)10-12/h12-18H,2-11H2,1H3/t12-,13+,14?,15-,16-/m0/s1 |
| InChIKey | BXGXGDPHYIVNLH-YKUJZXIWSA-N |
| XLogP | 1.73 |
| TPSA | 39.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |