C24H20N2O5 — CID 163122610
N-hydroxy-2-methyl-5-[[3-methyl-4-(2-oxochromen-3-yl)phenyl]carbamoyl]benzeneamine oxide (PubChem CID 163122610) has the molecular formula C24H20N2O5 and a molecular weight of 416.43 g/mol. Its IUPAC name is N-hydroxy-2-methyl-5-[[3-methyl-4-(2-oxochromen-3-yl)phenyl]carbamoyl]benzeneamine oxide.
| Compound Name | N-hydroxy-2-methyl-5-[[3-methyl-4-(2-oxochromen-3-yl)phenyl]carbamoyl]benzeneamine oxide |
|---|---|
| PubChem CID | 163122610 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | N-hydroxy-2-methyl-5-[[3-methyl-4-(2-oxochromen-3-yl)phenyl]carbamoyl]benzeneamine oxide |
| SMILES | Cc1cc(NC(=O)c2ccc(C)c([NH+]([O-])O)c2)ccc1-c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C24H20N2O5/c1-14-7-8-17(13-21(14)26(29)30)23(27)25-18-9-10-19(15(2)11-18)20-12-16-5-3-4-6-22(16)31-24(20)28/h3-13,26,29H,1-2H3,(H,25,27) |
| InChIKey | CAXAYUFUNHWATF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 107.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|