C28H34N4O6 — CID 163125391
(2S,3R)-3-(4-ethoxycarbonylpiperidine-1-carbonyl)-N-hydroxy-18-oxo-11,19-diazapentacyclo[11.7.1.02,11.05,10.014,19]henicosa-5(10),6,8,14,16-pentaen-7-amine oxide (PubChem CID 163125391) has the molecular formula C28H34N4O6 and a molecular weight of 522.60 g/mol. Its IUPAC name is (2S,3R)-3-(4-ethoxycarbonylpiperidine-1-carbonyl)-N-hydroxy-18-oxo-11,19-diazapentacyclo[11.7.1.02,11.05,10.014,19]henicosa-5(10),6,8,14,16-pentaen-7-amine oxide.
| Compound Name | (2S,3R)-3-(4-ethoxycarbonylpiperidine-1-carbonyl)-N-hydroxy-18-oxo-11,19-diazapentacyclo[11.7.1.02,11.05,10.014,19]henicosa-5(10),6,8,14,16-pentaen-7-amine oxide |
|---|---|
| PubChem CID | 163125391 |
| Molecular Formula | C28H34N4O6 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | (2S,3R)-3-(4-ethoxycarbonylpiperidine-1-carbonyl)-N-hydroxy-18-oxo-11,19-diazapentacyclo[11.7.1.02,11.05,10.014,19]henicosa-5(10),6,8,14,16-pentaen-7-amine oxide |
| SMILES | CCOC(=O)C1CCN(C(=O)[C@@H]2Cc3cc([NH+]([O-])O)ccc3N3CC4CC(Cn5c4cccc5=O)[C@@H]23)CC1 |
| InChI | InChI=1S/C28H34N4O6/c1-2-38-28(35)17-8-10-29(11-9-17)27(34)22-14-18-13-21(32(36)37)6-7-24(18)31-15-19-12-20(26(22)31)16-30-23(19)4-3-5-25(30)33/h3-7,13,17,19-20,22,26,32,36H,2,8-12,14-16H2,1H3/t19?,20?,22-,26+/m1/s1 |
| InChIKey | DCHZJOQTDUBKSX-BSVYFJRFSA-N |
| XLogP | 1.22 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|