C36H48N4O2 — CID 163127291
25-(2-oxido-3,9-dihydro-2H-pyrido[3,4-b]indol-2-ium-1-yl)-11,22-diazatetracyclo[11.11.2.12,22.02,12]heptacosa-5,16,25-trien-13-ol (PubChem CID 163127291) has the molecular formula C36H48N4O2 and a molecular weight of 568.81 g/mol. Its IUPAC name is 25-(2-oxido-3,9-dihydro-2H-pyrido[3,4-b]indol-2-ium-1-yl)-11,22-diazatetracyclo[11.11.2.12,22.02,12]heptacosa-5,16,25-trien-13-ol.
| Compound Name | 25-(2-oxido-3,9-dihydro-2H-pyrido[3,4-b]indol-2-ium-1-yl)-11,22-diazatetracyclo[11.11.2.12,22.02,12]heptacosa-5,16,25-trien-13-ol |
|---|---|
| PubChem CID | 163127291 |
| Molecular Formula | C36H48N4O2 |
| Molecular Weight | 568.81 g/mol |
| Exact Mass | 568.38 |
| IUPAC Name | 25-(2-oxido-3,9-dihydro-2H-pyrido[3,4-b]indol-2-ium-1-yl)-11,22-diazatetracyclo[11.11.2.12,22.02,12]heptacosa-5,16,25-trien-13-ol |
| SMILES | [O-][NH+]1CC=c2c([nH]c3ccccc23)=C1C1=CC2(O)CCC=CCCCCN3CCC1C1(CCC=CCCCCNC21)C3 |
| InChI | InChI=1S/C36H48N4O2/c41-36-20-12-6-2-4-8-14-22-39-23-18-30(35(26-39)19-11-5-1-3-7-13-21-37-34(35)36)29(25-36)33-32-28(17-24-40(33)42)27-15-9-10-16-31(27)38-32/h1-2,5-6,9-10,15-17,25,30,34,37-38,40-41H,3-4,7-8,11-14,18-24,26H2 |
| InChIKey | DUSQVGLQEIEJKG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.81 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|