C36H48N4O — CID 44575452
(1R,2R,5Z,12R,13S,18Z)-25-(4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)-11,22-diazatetracyclo[11.11.2.12,22.02,12]heptacosa-5,18,25-trien-13-ol (PubChem CID 44575452) has the molecular formula C36H48N4O and a molecular weight of 552.81 g/mol. Its IUPAC name is (1R,2R,5Z,12R,13S,18Z)-25-(4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)-11,22-diazatetracyclo[11.11.2.12,22.02,12]heptacosa-5,18,25-trien-13-ol.
| Compound Name | (1R,2R,5Z,12R,13S,18Z)-25-(4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)-11,22-diazatetracyclo[11.11.2.12,22.02,12]heptacosa-5,18,25-trien-13-ol |
|---|---|
| PubChem CID | 44575452 |
| Molecular Formula | C36H48N4O |
| Molecular Weight | 552.81 g/mol |
| Exact Mass | 552.38 |
| IUPAC Name | (1R,2R,5Z,12R,13S,18Z)-25-(4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)-11,22-diazatetracyclo[11.11.2.12,22.02,12]heptacosa-5,18,25-trien-13-ol |
| SMILES | O[C@]12C=C(C3=NCCc4c3[nH]c3ccccc43)[C@@H]3CCN(CC/C=C\CCCC1)C[C@@]31CC/C=C\CCCCN[C@H]12 |
| InChI | InChI=1S/C36H48N4O/c41-36-20-12-6-2-4-8-14-23-40-24-18-30(35(26-40)19-11-5-1-3-7-13-21-38-34(35)36)29(25-36)32-33-28(17-22-37-32)27-15-9-10-16-31(27)39-33/h1,4-5,8-10,15-16,25,30,34,38-39,41H,2-3,6-7,11-14,17-24,26H2/b5-1-,8-4-/t30-,34+,35-,36-/m0/s1 |
| InChIKey | LRUDBTRYFRCTLQ-BDYONYFUSA-N |
| XLogP | 6.49 |
| TPSA | 63.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.81 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|