C22H39NO3 — CID 163129201
4-(10,13-dimethyltetradecanoyl)-3-hydroxy-1,2-dimethyl-2H-pyrrol-5-one (PubChem CID 163129201) has the molecular formula C22H39NO3 and a molecular weight of 365.56 g/mol. Its IUPAC name is 4-(10,13-dimethyltetradecanoyl)-3-hydroxy-1,2-dimethyl-2H-pyrrol-5-one.
| Compound Name | 4-(10,13-dimethyltetradecanoyl)-3-hydroxy-1,2-dimethyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 163129201 |
| Molecular Formula | C22H39NO3 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.29 |
| IUPAC Name | 4-(10,13-dimethyltetradecanoyl)-3-hydroxy-1,2-dimethyl-2H-pyrrol-5-one |
| SMILES | CC(C)CCC(C)CCCCCCCCC(=O)C1=C(O)C(C)N(C)C1=O |
| InChI | InChI=1S/C22H39NO3/c1-16(2)14-15-17(3)12-10-8-6-7-9-11-13-19(24)20-21(25)18(4)23(5)22(20)26/h16-18,25H,6-15H2,1-5H3 |
| InChIKey | JHPLDEGMZKFQTL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|