C24H26N2O5 — CID 163129711
N-hydroxy-4-[N-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]anilino]oxycarbonylbenzeneamine oxide (PubChem CID 163129711) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is N-hydroxy-4-[N-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]anilino]oxycarbonylbenzeneamine oxide.
| Compound Name | N-hydroxy-4-[N-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]anilino]oxycarbonylbenzeneamine oxide |
|---|---|
| PubChem CID | 163129711 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-hydroxy-4-[N-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]anilino]oxycarbonylbenzeneamine oxide |
| SMILES | CC12CCC(C(=CN(OC(=O)c3ccc([NH+]([O-])O)cc3)c3ccccc3)C1=O)C2(C)C |
| InChI | InChI=1S/C24H26N2O5/c1-23(2)20-13-14-24(23,3)21(27)19(20)15-25(17-7-5-4-6-8-17)31-22(28)16-9-11-18(12-10-16)26(29)30/h4-12,15,20,26,29H,13-14H2,1-3H3 |
| InChIKey | FQZVODPNXONPGR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 94.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|