C24H25N2O5- — CID 163129716
[N-[[(1S,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]anilino] 4-[hydroxy(oxido)amino]benzoate (PubChem CID 163129716) has the molecular formula C24H25N2O5- and a molecular weight of 421.47 g/mol. Its IUPAC name is [N-[[(1S,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]anilino] 4-[hydroxy(oxido)amino]benzoate.
| Compound Name | [N-[[(1S,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]anilino] 4-[hydroxy(oxido)amino]benzoate |
|---|---|
| PubChem CID | 163129716 |
| Molecular Formula | C24H25N2O5- |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | [N-[[(1S,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]anilino] 4-[hydroxy(oxido)amino]benzoate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)C(=O)C2=CN(OC(=O)c1ccc(N([O-])O)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H25N2O5/c1-23(2)20-13-14-24(23,3)21(27)19(20)15-25(17-7-5-4-6-8-17)31-22(28)16-9-11-18(12-10-16)26(29)30/h4-12,15,20,29H,13-14H2,1-3H3/q-1/t20-,24+/m1/s1 |
| InChIKey | BJJSRCOSBXQLBD-YKSBVNFPSA-N |
| XLogP | 4.87 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|