C18H22NO5- — CID 163138183
[(1S,2S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]methyl 4-[hydroxy(oxido)amino]benzoate (PubChem CID 163138183) has the molecular formula C18H22NO5- and a molecular weight of 332.38 g/mol. Its IUPAC name is [(1S,2S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]methyl 4-[hydroxy(oxido)amino]benzoate.
| Compound Name | [(1S,2S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]methyl 4-[hydroxy(oxido)amino]benzoate |
|---|---|
| PubChem CID | 163138183 |
| Molecular Formula | C18H22NO5- |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | [(1S,2S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]methyl 4-[hydroxy(oxido)amino]benzoate |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)C(=O)[C@@H]2COC(=O)c1ccc(N([O-])O)cc1 |
| InChI | InChI=1S/C18H22NO5/c1-17(2)14-8-9-18(17,3)15(20)13(14)10-24-16(21)11-4-6-12(7-5-11)19(22)23/h4-7,13-14,22H,8-10H2,1-3H3/q-1/t13-,14+,18-/m1/s1 |
| InChIKey | SEEGUSYLHJCAOU-QWQRMKEZSA-N |
| XLogP | 3.18 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|