C15H28FN2+ — CID 163130578
1-[(3-fluorocyclohexyl)methyl]-2-methyl-2,3,4,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-4-ium (PubChem CID 163130578) has the molecular formula C15H28FN2+ and a molecular weight of 255.40 g/mol. Its IUPAC name is 1-[(3-fluorocyclohexyl)methyl]-2-methyl-2,3,4,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-4-ium.
| Compound Name | 1-[(3-fluorocyclohexyl)methyl]-2-methyl-2,3,4,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-4-ium |
|---|---|
| PubChem CID | 163130578 |
| Molecular Formula | C15H28FN2+ |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 1-[(3-fluorocyclohexyl)methyl]-2-methyl-2,3,4,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridin-4-ium |
| SMILES | CC1C[NH+]2CCCCC2N1CC1CCCC(F)C1 |
| InChI | InChI=1S/C15H27FN2/c1-12-10-17-8-3-2-7-15(17)18(12)11-13-5-4-6-14(16)9-13/h12-15H,2-11H2,1H3/p+1 |
| InChIKey | JQPTUIUDRJQZPM-UHFFFAOYSA-O |
| XLogP | 1.61 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |