C13H13ClN4O8 — CID 163131386
4-chloro-1-N,3-N-dihydroxy-5-[[3-[hydroxy(oxido)azaniumyl]phenoxy]carbonylamino]benzene-1,3-diamine oxide (PubChem CID 163131386) has the molecular formula C13H13ClN4O8 and a molecular weight of 388.72 g/mol. Its IUPAC name is 4-chloro-1-N,3-N-dihydroxy-5-[[3-[hydroxy(oxido)azaniumyl]phenoxy]carbonylamino]benzene-1,3-diamine oxide.
| Compound Name | 4-chloro-1-N,3-N-dihydroxy-5-[[3-[hydroxy(oxido)azaniumyl]phenoxy]carbonylamino]benzene-1,3-diamine oxide |
|---|---|
| PubChem CID | 163131386 |
| Molecular Formula | C13H13ClN4O8 |
| Molecular Weight | 388.72 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 4-chloro-1-N,3-N-dihydroxy-5-[[3-[hydroxy(oxido)azaniumyl]phenoxy]carbonylamino]benzene-1,3-diamine oxide |
| SMILES | O=C(Nc1cc([NH+]([O-])O)cc([NH+]([O-])O)c1Cl)Oc1cccc([NH+]([O-])O)c1 |
| InChI | InChI=1S/C13H13ClN4O8/c14-12-10(5-8(17(22)23)6-11(12)18(24)25)15-13(19)26-9-3-1-2-7(4-9)16(20)21/h1-6,16-18,20,22,24H,(H,15,19) |
| InChIKey | GHECGMKJIGHOQM-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 181.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.72 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|