C15H16NO5- — CID 163131632
[2-[hydroxy(oxido)amino]-4,5-dimethoxyphenyl]-phenylmethanol (PubChem CID 163131632) has the molecular formula C15H16NO5- and a molecular weight of 290.30 g/mol. Its IUPAC name is [2-[hydroxy(oxido)amino]-4,5-dimethoxyphenyl]-phenylmethanol.
| Compound Name | [2-[hydroxy(oxido)amino]-4,5-dimethoxyphenyl]-phenylmethanol |
|---|---|
| PubChem CID | 163131632 |
| Molecular Formula | C15H16NO5- |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | [2-[hydroxy(oxido)amino]-4,5-dimethoxyphenyl]-phenylmethanol |
| SMILES | COc1cc(C(O)c2ccccc2)c(N([O-])O)cc1OC |
| InChI | InChI=1S/C15H16NO5/c1-20-13-8-11(12(16(18)19)9-14(13)21-2)15(17)10-6-4-3-5-7-10/h3-9,15,17-18H,1-2H3/q-1 |
| InChIKey | AXDVCLUBOCUKKK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|