C23H43N7O3+2 — CID 163133562
1-[1-oxo-4-[3-oxo-3-(4-piperidin-1-ium-2-ylpiperazin-1-yl)propyl]-2,3,4,5,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-5-ium-7-yl]-3-propan-2-ylurea (PubChem CID 163133562) has the molecular formula C23H43N7O3+2 and a molecular weight of 465.64 g/mol. Its IUPAC name is 1-[1-oxo-4-[3-oxo-3-(4-piperidin-1-ium-2-ylpiperazin-1-yl)propyl]-2,3,4,5,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-5-ium-7-yl]-3-propan-2-ylurea.
| Compound Name | 1-[1-oxo-4-[3-oxo-3-(4-piperidin-1-ium-2-ylpiperazin-1-yl)propyl]-2,3,4,5,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-5-ium-7-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 163133562 |
| Molecular Formula | C23H43N7O3+2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.34 |
| IUPAC Name | 1-[1-oxo-4-[3-oxo-3-(4-piperidin-1-ium-2-ylpiperazin-1-yl)propyl]-2,3,4,5,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-5-ium-7-yl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NC1CC2C(=O)NCC(CCC(=O)N3CCN(C4CCCC[NH2+]4)CC3)[NH+]2C1 |
| InChI | InChI=1S/C23H41N7O3/c1-16(2)26-23(33)27-17-13-19-22(32)25-14-18(30(19)15-17)6-7-21(31)29-11-9-28(10-12-29)20-5-3-4-8-24-20/h16-20,24H,3-15H2,1-2H3,(H,25,32)(H2,26,27,33)/p+2 |
| InChIKey | AZYKMJZSJWHLJY-UHFFFAOYSA-P |
| XLogP | -2.78 |
| TPSA | 114.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |