C10H13O3+ — CID 163140527
(4-hydroxy-3-methyl-2,6,7,8-tetrahydrochromen-5-ylidene)oxidanium (PubChem CID 163140527) has the molecular formula C10H13O3+ and a molecular weight of 181.21 g/mol. Its IUPAC name is (4-hydroxy-3-methyl-2,6,7,8-tetrahydrochromen-5-ylidene)oxidanium.
| Compound Name | (4-hydroxy-3-methyl-2,6,7,8-tetrahydrochromen-5-ylidene)oxidanium |
|---|---|
| PubChem CID | 163140527 |
| Molecular Formula | C10H13O3+ |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (4-hydroxy-3-methyl-2,6,7,8-tetrahydrochromen-5-ylidene)oxidanium |
| SMILES | [H]/[O+]=C1\CCCC2=C1C(O)=C(C)CO2 |
| InChI | InChI=1S/C10H12O3/c1-6-5-13-8-4-2-3-7(11)9(8)10(6)12/h12H,2-5H2,1H3/p+1 |
| InChIKey | JPLDAQIJLFVYDE-UHFFFAOYSA-O |
| XLogP | 1.83 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|