C24H28N2O — CID 163142450
(10S)-10-[2-(diethylamino)ethyl]-12-methyl-12-azatetracyclo[9.7.0.03,8.013,18]octadeca-1(11),3,5,7,13,15,17-heptaen-2-one (PubChem CID 163142450) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is (10S)-10-[2-(diethylamino)ethyl]-12-methyl-12-azatetracyclo[9.7.0.03,8.013,18]octadeca-1(11),3,5,7,13,15,17-heptaen-2-one.
| Compound Name | (10S)-10-[2-(diethylamino)ethyl]-12-methyl-12-azatetracyclo[9.7.0.03,8.013,18]octadeca-1(11),3,5,7,13,15,17-heptaen-2-one |
|---|---|
| PubChem CID | 163142450 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | (10S)-10-[2-(diethylamino)ethyl]-12-methyl-12-azatetracyclo[9.7.0.03,8.013,18]octadeca-1(11),3,5,7,13,15,17-heptaen-2-one |
| SMILES | CCN(CC)CC[C@@H]1Cc2ccccc2C(=O)c2c1n(C)c1ccccc21 |
| InChI | InChI=1S/C24H28N2O/c1-4-26(5-2)15-14-18-16-17-10-6-7-11-19(17)24(27)22-20-12-8-9-13-21(20)25(3)23(18)22/h6-13,18H,4-5,14-16H2,1-3H3/t18-/m1/s1 |
| InChIKey | KHGVQMCNGRUSNM-GOSISDBHSA-N |
| XLogP | 4.78 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |