C8H14N4O5 — CID 163147707
[2-[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-2-carboxyethoxy]-2-oxoethyl]azaniumylideneazanide (PubChem CID 163147707) has the molecular formula C8H14N4O5 and a molecular weight of 246.22 g/mol. Its IUPAC name is [2-[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-2-carboxyethoxy]-2-oxoethyl]azaniumylideneazanide.
| Compound Name | [2-[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-2-carboxyethoxy]-2-oxoethyl]azaniumylideneazanide |
|---|---|
| PubChem CID | 163147707 |
| Molecular Formula | C8H14N4O5 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | [2-[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-2-carboxyethoxy]-2-oxoethyl]azaniumylideneazanide |
| SMILES | C[C@H](N)C(=O)N[C@@H](COC(=O)C[NH+]=[N-])C(=O)O |
| InChI | InChI=1S/C8H14N4O5/c1-4(9)7(14)12-5(8(15)16)3-17-6(13)2-11-10/h4-5,11H,2-3,9H2,1H3,(H,12,14)(H,15,16)/t4-,5-/m0/s1 |
| InChIKey | MEVGWBANQUFHJV-WHFBIAKZSA-N |
| XLogP | -3.45 |
| TPSA | 154.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|