C28H24N2O7 — CID 163147717
(1R)-N-hydroxy-2-(4-hydroxyphenyl)-1-[(23R)-24-methyl-5,7,18,20-tetraoxa-24-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(13),2,4(8),9,11,14(22),15,17(21)-octaen-23-yl]ethanamine oxide (PubChem CID 163147717) has the molecular formula C28H24N2O7 and a molecular weight of 500.51 g/mol. Its IUPAC name is (1R)-N-hydroxy-2-(4-hydroxyphenyl)-1-[(23R)-24-methyl-5,7,18,20-tetraoxa-24-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(13),2,4(8),9,11,14(22),15,17(21)-octaen-23-yl]ethanamine oxide.
| Compound Name | (1R)-N-hydroxy-2-(4-hydroxyphenyl)-1-[(23R)-24-methyl-5,7,18,20-tetraoxa-24-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(13),2,4(8),9,11,14(22),15,17(21)-octaen-23-yl]ethanamine oxide |
|---|---|
| PubChem CID | 163147717 |
| Molecular Formula | C28H24N2O7 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | (1R)-N-hydroxy-2-(4-hydroxyphenyl)-1-[(23R)-24-methyl-5,7,18,20-tetraoxa-24-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(13),2,4(8),9,11,14(22),15,17(21)-octaen-23-yl]ethanamine oxide |
| SMILES | CN1c2c(ccc3cc4c(cc23)OCO4)-c2ccc3c(c2[C@@H]1[C@@H](Cc1ccc(O)cc1)[NH+]([O-])O)OCO3 |
| InChI | InChI=1S/C28H24N2O7/c1-29-26-19(7-4-16-11-23-24(12-20(16)26)36-13-35-23)18-8-9-22-28(37-14-34-22)25(18)27(29)21(30(32)33)10-15-2-5-17(31)6-3-15/h2-9,11-12,21,27,30-32H,10,13-14H2,1H3/t21-,27+/m1/s1 |
| InChIKey | MEWGKUWLGBLZOB-ZBLYBZFDSA-N |
| XLogP | 3.54 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|