C26H32NO4- — CID 163157625
[4-[hydroxy(oxido)amino]phenyl] 1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate (PubChem CID 163157625) has the molecular formula C26H32NO4- and a molecular weight of 422.55 g/mol. Its IUPAC name is [4-[hydroxy(oxido)amino]phenyl] 1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate.
| Compound Name | [4-[hydroxy(oxido)amino]phenyl] 1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 163157625 |
| Molecular Formula | C26H32NO4- |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | [4-[hydroxy(oxido)amino]phenyl] 1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate |
| SMILES | C=C(C)C1=CC2=CCC3C(C)(C(=O)Oc4ccc(N([O-])O)cc4)CCCC3(C)C2CC1 |
| InChI | InChI=1S/C26H32NO4/c1-17(2)18-6-12-22-19(16-18)7-13-23-25(22,3)14-5-15-26(23,4)24(28)31-21-10-8-20(9-11-21)27(29)30/h7-11,16,22-23,29H,1,5-6,12-15H2,2-4H3/q-1 |
| InChIKey | LIQGXRMJWCQBAQ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|