C18H25NO5 — CID 163162301
N-hydroxy-4-[[(1S,3S,6R)-6-methyl-2-oxo-3-propan-2-ylcyclohexyl]methoxycarbonyl]benzeneamine oxide (PubChem CID 163162301) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is N-hydroxy-4-[[(1S,3S,6R)-6-methyl-2-oxo-3-propan-2-ylcyclohexyl]methoxycarbonyl]benzeneamine oxide.
| Compound Name | N-hydroxy-4-[[(1S,3S,6R)-6-methyl-2-oxo-3-propan-2-ylcyclohexyl]methoxycarbonyl]benzeneamine oxide |
|---|---|
| PubChem CID | 163162301 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N-hydroxy-4-[[(1S,3S,6R)-6-methyl-2-oxo-3-propan-2-ylcyclohexyl]methoxycarbonyl]benzeneamine oxide |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)[C@@H](COC(=O)c2ccc([NH+]([O-])O)cc2)C1=O |
| InChI | InChI=1S/C18H25NO5/c1-11(2)15-9-4-12(3)16(17(15)20)10-24-18(21)13-5-7-14(8-6-13)19(22)23/h5-8,11-12,15-16,19,22H,4,9-10H2,1-3H3/t12-,15+,16-/m1/s1 |
| InChIKey | RKMNLUDXAUAGQG-UHOFOFEASA-N |
| XLogP | 2.13 |
| TPSA | 91.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|