C19H18N6O3S — CID 163168475
N-hydroxy-3-[5-[5-(thiophen-2-ylmethyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-1,2,4-oxadiazol-3-yl]benzeneamine oxide (PubChem CID 163168475) has the molecular formula C19H18N6O3S and a molecular weight of 410.46 g/mol. Its IUPAC name is N-hydroxy-3-[5-[5-(thiophen-2-ylmethyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-1,2,4-oxadiazol-3-yl]benzeneamine oxide.
| Compound Name | N-hydroxy-3-[5-[5-(thiophen-2-ylmethyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-1,2,4-oxadiazol-3-yl]benzeneamine oxide |
|---|---|
| PubChem CID | 163168475 |
| Molecular Formula | C19H18N6O3S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | N-hydroxy-3-[5-[5-(thiophen-2-ylmethyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-1,2,4-oxadiazol-3-yl]benzeneamine oxide |
| SMILES | [O-][NH+](O)c1cccc(-c2noc(C3Cc4nc[nH]c4CN3Cc3cccs3)n2)c1 |
| InChI | InChI=1S/C19H18N6O3S/c26-25(27)13-4-1-3-12(7-13)18-22-19(28-23-18)17-8-15-16(21-11-20-15)10-24(17)9-14-5-2-6-29-14/h1-7,11,17,25-26H,8-10H2,(H,20,21) |
| InChIKey | UJNWPJBLNFHESE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|