C23H20F3N5O2 — CID 26744868
3-(3-methylphenyl)-5-[(6S)-5-[[3-(trifluoromethoxy)phenyl]methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-1,2,4-oxadiazole (PubChem CID 26744868) has the molecular formula C23H20F3N5O2 and a molecular weight of 455.44 g/mol. Its IUPAC name is 3-(3-methylphenyl)-5-[(6S)-5-[[3-(trifluoromethoxy)phenyl]methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(3-methylphenyl)-5-[(6S)-5-[[3-(trifluoromethoxy)phenyl]methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 26744868 |
| Molecular Formula | C23H20F3N5O2 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 3-(3-methylphenyl)-5-[(6S)-5-[[3-(trifluoromethoxy)phenyl]methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-1,2,4-oxadiazole |
| SMILES | Cc1cccc(-c2noc([C@@H]3Cc4nc[nH]c4CN3Cc3cccc(OC(F)(F)F)c3)n2)c1 |
| InChI | InChI=1S/C23H20F3N5O2/c1-14-4-2-6-16(8-14)21-29-22(33-30-21)20-10-18-19(28-13-27-18)12-31(20)11-15-5-3-7-17(9-15)32-23(24,25)26/h2-9,13,20H,10-12H2,1H3,(H,27,28)/t20-/m0/s1 |
| InChIKey | ZRATWQDNDWPKEN-FQEVSTJZSA-N |
| XLogP | 4.97 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |