C20H16F3N7O — CID 26744742
3-pyrazin-2-yl-5-[(6S)-5-[[4-(trifluoromethyl)phenyl]methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-1,2,4-oxadiazole (PubChem CID 26744742) has the molecular formula C20H16F3N7O and a molecular weight of 427.39 g/mol. Its IUPAC name is 3-pyrazin-2-yl-5-[(6S)-5-[[4-(trifluoromethyl)phenyl]methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-1,2,4-oxadiazole.
| Compound Name | 3-pyrazin-2-yl-5-[(6S)-5-[[4-(trifluoromethyl)phenyl]methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 26744742 |
| Molecular Formula | C20H16F3N7O |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 3-pyrazin-2-yl-5-[(6S)-5-[[4-(trifluoromethyl)phenyl]methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-1,2,4-oxadiazole |
| SMILES | FC(F)(F)c1ccc(CN2Cc3[nH]cnc3C[C@H]2c2nc(-c3cnccn3)no2)cc1 |
| InChI | InChI=1S/C20H16F3N7O/c21-20(22,23)13-3-1-12(2-4-13)9-30-10-16-14(26-11-27-16)7-17(30)19-28-18(29-31-19)15-8-24-5-6-25-15/h1-6,8,11,17H,7,9-10H2,(H,26,27)/t17-/m0/s1 |
| InChIKey | WUCYVCKWIFHUHV-KRWDZBQOSA-N |
| XLogP | 3.57 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |