C19H16N8O3 — CID 26744732
5-[(6S)-5-[(4-nitrophenyl)methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-3-pyrazin-2-yl-1,2,4-oxadiazole (PubChem CID 26744732) has the molecular formula C19H16N8O3 and a molecular weight of 404.39 g/mol. Its IUPAC name is 5-[(6S)-5-[(4-nitrophenyl)methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-3-pyrazin-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-[(6S)-5-[(4-nitrophenyl)methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-3-pyrazin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 26744732 |
| Molecular Formula | C19H16N8O3 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 5-[(6S)-5-[(4-nitrophenyl)methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-3-pyrazin-2-yl-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(CN2Cc3[nH]cnc3C[C@H]2c2nc(-c3cnccn3)no2)cc1 |
| InChI | InChI=1S/C19H16N8O3/c28-27(29)13-3-1-12(2-4-13)9-26-10-16-14(22-11-23-16)7-17(26)19-24-18(25-30-19)15-8-20-5-6-21-15/h1-6,8,11,17H,7,9-10H2,(H,22,23)/t17-/m0/s1 |
| InChIKey | DZBVSVBVYAARCS-KRWDZBQOSA-N |
| XLogP | 2.46 |
| TPSA | 139.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|