C12H14F3N3OS — CID 163170075
(3R,5R)-5-hydroxy-3-methyl-3-phenyl-5-(trifluoromethyl)pyrazolidine-1-carbothioamide (PubChem CID 163170075) has the molecular formula C12H14F3N3OS and a molecular weight of 305.32 g/mol. Its IUPAC name is (3R,5R)-5-hydroxy-3-methyl-3-phenyl-5-(trifluoromethyl)pyrazolidine-1-carbothioamide.
| Compound Name | (3R,5R)-5-hydroxy-3-methyl-3-phenyl-5-(trifluoromethyl)pyrazolidine-1-carbothioamide |
|---|---|
| PubChem CID | 163170075 |
| Molecular Formula | C12H14F3N3OS |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | (3R,5R)-5-hydroxy-3-methyl-3-phenyl-5-(trifluoromethyl)pyrazolidine-1-carbothioamide |
| SMILES | C[C@]1(c2ccccc2)C[C@@](O)(C(F)(F)F)N(C(N)=S)N1 |
| InChI | InChI=1S/C12H14F3N3OS/c1-10(8-5-3-2-4-6-8)7-11(19,12(13,14)15)18(17-10)9(16)20/h2-6,17,19H,7H2,1H3,(H2,16,20)/t10-,11-/m1/s1 |
| InChIKey | UZSJFPRHXZJBGC-GHMZBOCLSA-N |
| XLogP | 1.61 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|