C12H22O2S2 — CID 163171824
4-methyl-6-sulfinosulfanylundeca-1,9-diene (PubChem CID 163171824) has the molecular formula C12H22O2S2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 4-methyl-6-sulfinosulfanylundeca-1,9-diene.
| Compound Name | 4-methyl-6-sulfinosulfanylundeca-1,9-diene |
|---|---|
| PubChem CID | 163171824 |
| Molecular Formula | C12H22O2S2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-methyl-6-sulfinosulfanylundeca-1,9-diene |
| SMILES | C=CCC(C)CC(CCC=CC)SS(=O)O |
| InChI | InChI=1S/C12H22O2S2/c1-4-6-7-9-12(15-16(13)14)10-11(3)8-5-2/h4-6,11-12H,2,7-10H2,1,3H3,(H,13,14) |
| InChIKey | XKNRDMVVWZSDAA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|