C11H22O3S — CID 159531560
(4R,5S,7R)-9-hydroxy-4,7-dimethylnon-1-ene-5-sulfinic acid (PubChem CID 159531560) has the molecular formula C11H22O3S and a molecular weight of 234.36 g/mol. Its IUPAC name is (4R,5S,7R)-9-hydroxy-4,7-dimethylnon-1-ene-5-sulfinic acid.
| Compound Name | (4R,5S,7R)-9-hydroxy-4,7-dimethylnon-1-ene-5-sulfinic acid |
|---|---|
| PubChem CID | 159531560 |
| Molecular Formula | C11H22O3S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (4R,5S,7R)-9-hydroxy-4,7-dimethylnon-1-ene-5-sulfinic acid |
| SMILES | C=CC[C@@H](C)[C@H](C[C@H](C)CCO)S(=O)O |
| InChI | InChI=1S/C11H22O3S/c1-4-5-10(3)11(15(13)14)8-9(2)6-7-12/h4,9-12H,1,5-8H2,2-3H3,(H,13,14)/t9-,10-,11+/m1/s1 |
| InChIKey | QQYVLIZWEXZNQN-MXWKQRLJSA-N |
| XLogP | 2.20 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|