C17H18O6 — CID 163178305
methyl (3S)-3-[3-(furan-2-yl)prop-2-enoyl]-2-hydroxy-6,6-dimethyl-4-oxocyclohexene-1-carboxylate (PubChem CID 163178305) has the molecular formula C17H18O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is methyl (3S)-3-[3-(furan-2-yl)prop-2-enoyl]-2-hydroxy-6,6-dimethyl-4-oxocyclohexene-1-carboxylate.
| Compound Name | methyl (3S)-3-[3-(furan-2-yl)prop-2-enoyl]-2-hydroxy-6,6-dimethyl-4-oxocyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 163178305 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | methyl (3S)-3-[3-(furan-2-yl)prop-2-enoyl]-2-hydroxy-6,6-dimethyl-4-oxocyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C(O)[C@H](C(=O)C=Cc2ccco2)C(=O)CC1(C)C |
| InChI | InChI=1S/C17H18O6/c1-17(2)9-12(19)13(15(20)14(17)16(21)22-3)11(18)7-6-10-5-4-8-23-10/h4-8,13,20H,9H2,1-3H3/t13-/m1/s1 |
| InChIKey | YDHVZWPMUXEZCS-CYBMUJFWSA-N |
| XLogP | 2.46 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|