C15H15BrO4 — CID 98615534
cis-(2S,4R)-4-bromo-2-[(E)-3-(furan-2-yl)prop-2-enoyl]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 98615534) has the molecular formula C15H15BrO4 and a molecular weight of 339.19 g/mol. Its IUPAC name is cis-(2S,4R)-4-bromo-2-[(E)-3-(furan-2-yl)prop-2-enoyl]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | cis-(2S,4R)-4-bromo-2-[(E)-3-(furan-2-yl)prop-2-enoyl]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 98615534 |
| Molecular Formula | C15H15BrO4 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | cis-(2S,4R)-4-bromo-2-[(E)-3-(furan-2-yl)prop-2-enoyl]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)[C@@H](C(=O)/C=C/c2ccco2)C(=O)[C@@H]1Br |
| InChI | InChI=1S/C15H15BrO4/c1-15(2)8-11(18)12(13(19)14(15)16)10(17)6-5-9-4-3-7-20-9/h3-7,12,14H,8H2,1-2H3/b6-5+/t12-,14+/m1/s1 |
| InChIKey | UMCMRJQFKGPVLH-LJXRPBPOSA-N |
| XLogP | 2.81 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|