C17H30NO+ — CID 163181474
1-methyl-3-[(1S,2S,5R,6R,9S)-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]piperidin-1-ium (PubChem CID 163181474) has the molecular formula C17H30NO+ and a molecular weight of 264.43 g/mol. Its IUPAC name is 1-methyl-3-[(1S,2S,5R,6R,9S)-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]piperidin-1-ium.
| Compound Name | 1-methyl-3-[(1S,2S,5R,6R,9S)-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]piperidin-1-ium |
|---|---|
| PubChem CID | 163181474 |
| Molecular Formula | C17H30NO+ |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | 1-methyl-3-[(1S,2S,5R,6R,9S)-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]piperidin-1-ium |
| SMILES | CC1=C[C@@H](C)[C@H]2CO[C@H](C3CCC[NH+](C)C3)[C@H]1[C@H]2C |
| InChI | InChI=1S/C17H29NO/c1-11-8-12(2)16-13(3)15(11)10-19-17(16)14-6-5-7-18(4)9-14/h8,11,13-17H,5-7,9-10H2,1-4H3/p+1/t11-,13+,14?,15-,16-,17-/m1/s1 |
| InChIKey | WPTFQHGMVBESBZ-LYHPYRSTSA-O |
| XLogP | 1.77 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|