C20H28O2 — CID 163184050
(4bS,8S,8aR)-8-(hydroxymethyl)-4b,8-dimethyl-2-propan-2-yl-5,8a,9,10-tetrahydrophenanthren-1-ol (PubChem CID 163184050) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (4bS,8S,8aR)-8-(hydroxymethyl)-4b,8-dimethyl-2-propan-2-yl-5,8a,9,10-tetrahydrophenanthren-1-ol.
| Compound Name | (4bS,8S,8aR)-8-(hydroxymethyl)-4b,8-dimethyl-2-propan-2-yl-5,8a,9,10-tetrahydrophenanthren-1-ol |
|---|---|
| PubChem CID | 163184050 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (4bS,8S,8aR)-8-(hydroxymethyl)-4b,8-dimethyl-2-propan-2-yl-5,8a,9,10-tetrahydrophenanthren-1-ol |
| SMILES | CC(C)c1ccc2c(c1O)CC[C@H]1[C@@](C)(CO)C=CC[C@]21C |
| InChI | InChI=1S/C20H28O2/c1-13(2)14-6-8-16-15(18(14)22)7-9-17-19(3,12-21)10-5-11-20(16,17)4/h5-6,8,10,13,17,21-22H,7,9,11-12H2,1-4H3/t17-,19+,20+/m0/s1 |
| InChIKey | TTYOQFCRRRQAFK-DFQSSKMNSA-N |
| XLogP | 4.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|