C22H30O5 — CID 101018420
methyl (1S,4aS,10aS)-8-(methoxymethoxy)-4a-methyl-2-oxo-7-propan-2-yl-1,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 101018420) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is methyl (1S,4aS,10aS)-8-(methoxymethoxy)-4a-methyl-2-oxo-7-propan-2-yl-1,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1S,4aS,10aS)-8-(methoxymethoxy)-4a-methyl-2-oxo-7-propan-2-yl-1,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 101018420 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | methyl (1S,4aS,10aS)-8-(methoxymethoxy)-4a-methyl-2-oxo-7-propan-2-yl-1,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | COCOc1c(C(C)C)ccc2c1CC[C@H]1[C@H](C(=O)OC)C(=O)CC[C@]21C |
| InChI | InChI=1S/C22H30O5/c1-13(2)14-6-8-16-15(20(14)27-12-25-4)7-9-17-19(21(24)26-5)18(23)10-11-22(16,17)3/h6,8,13,17,19H,7,9-12H2,1-5H3/t17-,19-,22+/m0/s1 |
| InChIKey | GEEVTIJWSLZBEP-LQBOVUBWSA-N |
| XLogP | 3.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|