C20H28O2 — CID 11781571
(2S,4aS)-8-methoxy-1,4a-dimethyl-7-propan-2-yl-3,4,9,10-tetrahydro-2H-phenanthren-2-ol (PubChem CID 11781571) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (2S,4aS)-8-methoxy-1,4a-dimethyl-7-propan-2-yl-3,4,9,10-tetrahydro-2H-phenanthren-2-ol.
| Compound Name | (2S,4aS)-8-methoxy-1,4a-dimethyl-7-propan-2-yl-3,4,9,10-tetrahydro-2H-phenanthren-2-ol |
|---|---|
| PubChem CID | 11781571 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (2S,4aS)-8-methoxy-1,4a-dimethyl-7-propan-2-yl-3,4,9,10-tetrahydro-2H-phenanthren-2-ol |
| SMILES | COc1c(C(C)C)ccc2c1CCC1=C(C)[C@@H](O)CC[C@@]12C |
| InChI | InChI=1S/C20H28O2/c1-12(2)14-6-9-17-15(19(14)22-5)7-8-16-13(3)18(21)10-11-20(16,17)4/h6,9,12,18,21H,7-8,10-11H2,1-5H3/t18-,20-/m0/s1 |
| InChIKey | LSBFCILSVTTYFJ-ICSRJNTNSA-N |
| XLogP | 4.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|