C20H27O5S- — CID 171150747
(4bS,8R,8aR)-8-methoxycarbonyl-4b-methyl-2-propan-2-yl-6,7,8,8a,9,10-hexahydro-5H-phenanthrene-3-sulfonate (PubChem CID 171150747) has the molecular formula C20H27O5S- and a molecular weight of 379.50 g/mol. Its IUPAC name is (4bS,8R,8aR)-8-methoxycarbonyl-4b-methyl-2-propan-2-yl-6,7,8,8a,9,10-hexahydro-5H-phenanthrene-3-sulfonate.
| Compound Name | (4bS,8R,8aR)-8-methoxycarbonyl-4b-methyl-2-propan-2-yl-6,7,8,8a,9,10-hexahydro-5H-phenanthrene-3-sulfonate |
|---|---|
| PubChem CID | 171150747 |
| Molecular Formula | C20H27O5S- |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (4bS,8R,8aR)-8-methoxycarbonyl-4b-methyl-2-propan-2-yl-6,7,8,8a,9,10-hexahydro-5H-phenanthrene-3-sulfonate |
| SMILES | COC(=O)[C@@H]1CCC[C@]2(C)c3cc(S(=O)(=O)[O-])c(C(C)C)cc3CC[C@H]12 |
| InChI | InChI=1S/C20H28O5S/c1-12(2)15-10-13-7-8-16-14(19(21)25-4)6-5-9-20(16,3)17(13)11-18(15)26(22,23)24/h10-12,14,16H,5-9H2,1-4H3,(H,22,23,24)/p-1/t14-,16-,20+/m1/s1 |
| InChIKey | SBJMXNNMKVDLSZ-KKVAFCGZSA-M |
| XLogP | 3.51 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|