C42H52O4 — CID 101126351
[(1S,2S,5R)-5-methyl-2-[2-(4-phenylphenyl)propan-2-yl]cyclohexyl] (1S,4aS,10aS)-8-methoxy-4a-methyl-2-oxo-7-propan-2-yl-1,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 101126351) has the molecular formula C42H52O4 and a molecular weight of 620.87 g/mol. Its IUPAC name is [(1S,2S,5R)-5-methyl-2-[2-(4-phenylphenyl)propan-2-yl]cyclohexyl] (1S,4aS,10aS)-8-methoxy-4a-methyl-2-oxo-7-propan-2-yl-1,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | [(1S,2S,5R)-5-methyl-2-[2-(4-phenylphenyl)propan-2-yl]cyclohexyl] (1S,4aS,10aS)-8-methoxy-4a-methyl-2-oxo-7-propan-2-yl-1,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 101126351 |
| Molecular Formula | C42H52O4 |
| Molecular Weight | 620.87 g/mol |
| Exact Mass | 620.39 |
| IUPAC Name | [(1S,2S,5R)-5-methyl-2-[2-(4-phenylphenyl)propan-2-yl]cyclohexyl] (1S,4aS,10aS)-8-methoxy-4a-methyl-2-oxo-7-propan-2-yl-1,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | COc1c(C(C)C)ccc2c1CC[C@H]1[C@H](C(=O)O[C@H]3C[C@H](C)CC[C@H]3C(C)(C)c3ccc(-c4ccccc4)cc3)C(=O)CC[C@]21C |
| InChI | InChI=1S/C42H52O4/c1-26(2)31-18-21-33-32(39(31)45-7)19-22-35-38(36(43)23-24-42(33,35)6)40(44)46-37-25-27(3)13-20-34(37)41(4,5)30-16-14-29(15-17-30)28-11-9-8-10-12-28/h8-12,14-18,21,26-27,34-35,37-38H,13,19-20,22-25H2,1-7H3/t27-,34-,35+,37+,38+,42-/m1/s1 |
| InChIKey | DHIYOJPMLXXMNP-BEONJTMYSA-N |
| XLogP | 9.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.87 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|