C36H50O4 — CID 101126341
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E)-9-(2-methoxy-3-propan-2-ylphenyl)-6-methyl-3-oxonon-6-enoate (PubChem CID 101126341) has the molecular formula C36H50O4 and a molecular weight of 546.79 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E)-9-(2-methoxy-3-propan-2-ylphenyl)-6-methyl-3-oxonon-6-enoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E)-9-(2-methoxy-3-propan-2-ylphenyl)-6-methyl-3-oxonon-6-enoate |
|---|---|
| PubChem CID | 101126341 |
| Molecular Formula | C36H50O4 |
| Molecular Weight | 546.79 g/mol |
| Exact Mass | 546.37 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E)-9-(2-methoxy-3-propan-2-ylphenyl)-6-methyl-3-oxonon-6-enoate |
| SMILES | COc1c(CC/C=C(\C)CCC(=O)CC(=O)O[C@@H]2C[C@H](C)CC[C@H]2C(C)(C)c2ccccc2)cccc1C(C)C |
| InChI | InChI=1S/C36H50O4/c1-25(2)31-18-12-15-28(35(31)39-7)14-11-13-26(3)19-21-30(37)24-34(38)40-33-23-27(4)20-22-32(33)36(5,6)29-16-9-8-10-17-29/h8-10,12-13,15-18,25,27,32-33H,11,14,19-24H2,1-7H3/b26-13+/t27-,32-,33-/m1/s1 |
| InChIKey | HVWNCDWRKNOFAQ-QRUKFRPJSA-N |
| XLogP | 8.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.79 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|