C22H32O4 — CID 101018412
ethyl (E)-9-(2-methoxy-3-propan-2-ylphenyl)-6-methyl-3-oxonon-6-enoate (PubChem CID 101018412) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is ethyl (E)-9-(2-methoxy-3-propan-2-ylphenyl)-6-methyl-3-oxonon-6-enoate.
| Compound Name | ethyl (E)-9-(2-methoxy-3-propan-2-ylphenyl)-6-methyl-3-oxonon-6-enoate |
|---|---|
| PubChem CID | 101018412 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | ethyl (E)-9-(2-methoxy-3-propan-2-ylphenyl)-6-methyl-3-oxonon-6-enoate |
| SMILES | CCOC(=O)CC(=O)CC/C(C)=C/CCc1cccc(C(C)C)c1OC |
| InChI | InChI=1S/C22H32O4/c1-6-26-21(24)15-19(23)14-13-17(4)9-7-10-18-11-8-12-20(16(2)3)22(18)25-5/h8-9,11-12,16H,6-7,10,13-15H2,1-5H3/b17-9+ |
| InChIKey | BZHWQSNANHZLGV-RQZCQDPDSA-N |
| XLogP | 5.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|