C36H47ClO4 — CID 10840957
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1S,4aS,10aR)-1-chloro-8-methoxy-4a-methyl-2-oxo-7-propan-2-yl-4,9,10,10a-tetrahydro-3H-phenanthrene-1-carboxylate (PubChem CID 10840957) has the molecular formula C36H47ClO4 and a molecular weight of 579.22 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1S,4aS,10aR)-1-chloro-8-methoxy-4a-methyl-2-oxo-7-propan-2-yl-4,9,10,10a-tetrahydro-3H-phenanthrene-1-carboxylate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1S,4aS,10aR)-1-chloro-8-methoxy-4a-methyl-2-oxo-7-propan-2-yl-4,9,10,10a-tetrahydro-3H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 10840957 |
| Molecular Formula | C36H47ClO4 |
| Molecular Weight | 579.22 g/mol |
| Exact Mass | 578.32 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1S,4aS,10aR)-1-chloro-8-methoxy-4a-methyl-2-oxo-7-propan-2-yl-4,9,10,10a-tetrahydro-3H-phenanthrene-1-carboxylate |
| SMILES | COc1c(C(C)C)ccc2c1CC[C@H]1[C@@](Cl)(C(=O)O[C@@H]3C[C@H](C)CC[C@H]3C(C)(C)c3ccccc3)C(=O)CC[C@]21C |
| InChI | InChI=1S/C36H47ClO4/c1-22(2)25-14-17-27-26(32(25)40-7)15-18-30-35(27,6)20-19-31(38)36(30,37)33(39)41-29-21-23(3)13-16-28(29)34(4,5)24-11-9-8-10-12-24/h8-12,14,17,22-23,28-30H,13,15-16,18-21H2,1-7H3/t23-,28-,29-,30-,35-,36+/m1/s1 |
| InChIKey | KVFZIFRMMUSGIG-QDDKDEPPSA-N |
| XLogP | 8.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.22 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|