C30H50N2O2 — CID 163185349
(1R,7S,9S,15R,21R,23R,29S,30R)-9,23-dimethyl-11,25-diazapentacyclo[19.7.1.17,11.025,29.015,30]triacontane-8,22-dione (PubChem CID 163185349) has the molecular formula C30H50N2O2 and a molecular weight of 470.74 g/mol. Its IUPAC name is (1R,7S,9S,15R,21R,23R,29S,30R)-9,23-dimethyl-11,25-diazapentacyclo[19.7.1.17,11.025,29.015,30]triacontane-8,22-dione.
| Compound Name | (1R,7S,9S,15R,21R,23R,29S,30R)-9,23-dimethyl-11,25-diazapentacyclo[19.7.1.17,11.025,29.015,30]triacontane-8,22-dione |
|---|---|
| PubChem CID | 163185349 |
| Molecular Formula | C30H50N2O2 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.39 |
| IUPAC Name | (1R,7S,9S,15R,21R,23R,29S,30R)-9,23-dimethyl-11,25-diazapentacyclo[19.7.1.17,11.025,29.015,30]triacontane-8,22-dione |
| SMILES | C[C@@H]1CN2CCC[C@H]3CCCCC[C@@H]4C(=O)[C@@H](C)CN5CCC[C@@H](CCCCC[C@@H](C1=O)[C@H]32)[C@H]45 |
| InChI | InChI=1S/C30H50N2O2/c1-21-19-31-17-9-13-23-11-6-4-8-16-26-28-24(14-10-18-32(28)20-22(2)30(26)34)12-5-3-7-15-25(27(23)31)29(21)33/h21-28H,3-20H2,1-2H3/t21-,22+,23-,24-,25-,26+,27+,28-/m1/s1 |
| InChIKey | OCNVVYBTRKWBCO-HUMLHTSFSA-N |
| XLogP | 5.73 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |